| Product ID
|
Category
|
| P14592-EOPOEOBr |
Poly(ethylene oxide)-b-poly(propylene oxide)-b-poly(ethylene oxide), (α-methoxy, ω-bromo)-terminated |
| P14593A-NIPAMSH |
Poly(N-isopropyl acrylamide), ω-thiol-terminated |
| P14593B-NIPAMSH |
Poly(N-isopropyl acrylamide), ω-thiol-terminated |
| P14612-NIPAM |
Poly(N-isopropyl acrylamide), narrow dispesity (Mw/Mn<1.6) |
| P14612F2-NIPAM |
Poly(N-isopropyl acrylamide), narrow dispesity (Mw/Mn<1.6) |
| P14612F3-NIPAM |
Poly(N-isopropyl acrylamide), narrow dispesity (Mw/Mn<1.6) |
| P14612F3-R-NIPAM |
Poly(N-isopropyl acrylamide), narrow dispesity (Mw/Mn<1.6) |
| P14612F4-NIPAM |
Poly(N-isopropyl acrylamide), narrow dispesity (Mw/Mn<1.6) |
| P14613-ANa |
Poly(acrylic acid sodium salt) |
| P14614-ANa |
Poly(acrylic acid sodium salt) |
| P14652A-NVPNH2 |
Poly(N-vinyl pyrrolidone), α-amino-terminated |
| P14652B-NVPNH2 |
Poly(N-vinyl pyrrolidone), α-amino-terminated |
| P14652C-NVPNH2 |
Poly(N-vinyl pyrrolidone), α-amino-terminated |
| P14652D-NVPNH2 |
Poly(N-vinyl pyrrolidone), α-amino-terminated |
| P1466-S2OH |
Poly(styrene), α,ω-bis(hydroxy)-terminated, with α-methylstyrene dimer in center of polymer chain |
| P1467-S2OH |
Poly(styrene), α,ω-bis(hydroxy)-terminated, with α-methylstyrene dimer in center of polymer chain |
| P14671A-SMMAranOHT |
Poly(styrene–co–methyl methacrylate), (α-hydroxy, ω-TEMPO)-terminated |
| P14671B-SMMAranOHT |
Poly(styrene–co–methyl methacrylate), (α-hydroxy, ω-TEMPO)-terminated |
| P14671C-SMMAranOHT |
Poly(styrene–co–methyl methacrylate), (α-hydroxy, ω-TEMPO)-terminated |
| P14671DF1-SMMAranOHT |
Poly(styrene–co–methyl methacrylate), (α-hydroxy, ω-TEMPO)-terminated |
| P14671DF2-SMMAranOHT |
Poly(styrene–co–methyl methacrylate), (α-hydroxy, ω-TEMPO)-terminated |
| P14671DF3-SMMAranOHT |
Poly(styrene–co–methyl methacrylate), (α-hydroxy, ω-TEMPO)-terminated |
| P14671DF4-SMMAranOHT |
Poly(styrene–co–methyl methacrylate), (α-hydroxy, ω-TEMPO)-terminated |
| P14671DF5-SMMAranOHT |
Poly(styrene–co–methyl methacrylate), (α-hydroxy, ω-TEMPO)-terminated |
| P1468-S2OH |
Poly(styrene), α,ω-bis(hydroxy)-terminated, with α-methylstyrene dimer in center of polymer chain |
| P1470-6ABd |
Poly([1,2–co–1,4]-butadiene), 6-arm star polymer / Core: poly([1,2–co–1,4]-butadiene), silyl-terminated |
| P14702-4EOCL-DNB |
Poly(ethylene oxide)-b-poly(ε-caprolactone), 4-arm block star, ω-(dinitrophenyl)sulfanylethyl-terminated / Core: pentaerythritol |
| P14712-DMSSiH |
Poly(dimethylsiloxane), ω-(dimethyl silane)-terminated |
| P14713-DMSSiH |
Poly(dimethylsiloxane), ω-(dimethyl silane)-terminated |
| P14713A-DMS-CH2CH(CH3)COOH |
Poly(dimethylsiloxane), ω-(carboxy propyl)-terminated |
| P1471B-SMMAalt |
Poly(styrene–alt–methyl methacrylate), alternating |
| P14749-CLOHSH |
Poly(ε-caprolactone), (α-thiol, ω-hydroxy)-terminated |
| P14749B-CLVLOHSH |
Poly(ε-caprolactone–co–δ-valerolactone), (α-thiol, ω-hydroxy)-terminated |
| P14755-DMS2COOH |
Poly(dimethylsiloxane), α,ω-bis(carboxy decyl)-terminated |
| P14757-DMS2COOH |
Poly(dimethylsiloxane), α,ω-bis(carboxy)-terminated |
| P14785-BBL |
Poly(benzimidazobenzophenanthroline) |
| P14785A-BBL |
Poly(benzimidazobenzophenanthroline) |
| P14791-BBL |
Poly(benzimidazobenzophenanthroline) |
| P1486-SNH2 |
Poly(styrene), ω-amino-terminated (via silane linkage) |
| P1486-SSiH |
Poly(styrene), ω-dimethylsilyl-terminate |
| P14864-EG2SH |
Poly(ethylene glycol), α,ω-bis(thiol)-terminated |
| P1488-SNH2 |
Poly(styrene), ω-amino-terminated (via silane linkage) |
| P1488-SSiH |
Poly(styrene), ω-dimethylsilyl-terminate |
| P14900-EG2SH |
Poly(ethylene glycol), α,ω-bis(thiol)-terminated |
| P14916-EG2SH |
Poly(ethylene glycol), α,ω-bis(thiol)-terminated |
| P14938-S-An |
Poly(styrene), α-(anthracen-9-yl)-terminated |
| P14939-MMA-An |
Poly(methyl methacrylate), (α-anthracen-9-yl, ω-bromo)-terminated |
| P1494-S |
Poly(styrene), atactic; narrow dispersity (Mw/Mn<1.2) |
| P1495-S |
Poly(styrene), atactic; narrow dispersity (Mw/Mn<1.2) |
| P14952-S-An |
Poly(styrene), α-(anthracen-9-yl)-terminated |
